summaryrefslogtreecommitdiff
path: root/src/usr.bin/openssl/ca.c (follow)
Commit message (Collapse)AuthorAgeFilesLines
...
* Remove engine command and parameters from openssl(1).bcook2015-09-111-27/+9
| | | | | | | We do not have any builtin or dynamic engines, meaning openssl(1) has no way to use the engine command or parameters at all. ok jsing@
* Correct spelling of OPENSSL_cleanse.jsing2015-09-101-2/+2
|
* Remove unused defines. No binary change.lteo2015-09-101-6/+1
| | | | ok deraadt@ miod@
* Remove all duplicate prototypes for *_main functions (these are alreadyjsing2015-08-221-3/+1
| | | | | | | | | provided by progs.h). Also, move the FUNCTION type (and flags) into openssl.c since that is the only place of use. Lastly, remove pointless 'extern' from the prototypes and use char **argv instead of char *argv[] (the former is used elsewhere). ok deraadt@ doug@
* Revert ca.c r1.7 - BN_to_ASN1_INTEGER() only allocates an ASN.1 integerjsing2015-07-221-6/+2
| | | | | | | | | when it is not passed a reference to one. In this case, it is passed a reference to an ASN.1 integer that is part of the X509 ASN.1 data structure. Freeing this causes bad things to happen, since it is used and then freed later on. Found the hard way by kinichiro inoguchi.
* Free memory when finished.doug2015-07-191-2/+6
| | | | | | Fixes coverity 78835. ok bcook@
* Remove effectively unused variable.doug2015-07-191-4/+1
| | | | | | Fixes Coverity issue 21693. ok beck@ bcook@
* Delete commented out code from openssl(1) apps.doug2015-02-081-13/+1
| | | | | | | | | | From OpenSSL commits: 6f91b017bbb7140f816721141ac156d1b828a6b3 75d0ebef2aef7a2c77b27575b8da898e22f3ccd5 a2b18e657ea1a932d125154f4e13ab2258796d90 ok miod@, jsing@
* Modify BSIZE to BUFLEN to avoid redefinition on HP-UX.bcook2015-02-071-3/+3
| | | | | | | | | | HP-UX defines BSIZE in its <sys/param.h>, and there is a route where its getting included as a side-effect. I tracked back to at least from HP-UX 9.0 ca. 1993, up to the latest, so the user namespace is polluted. from kinichiro <kinichiro.inoguchi@gmail.com> ok miod@, jsing@
* Enable -Wshadow in openssl(1) and fix a few shadow warnings.doug2014-09-011-7/+7
| | | | ok jsing@
* openssl_setup() calls SSL_load_error_strings(), which happens to calljsing2014-08-281-2/+1
| | | | | ERR_load_crypto_strings() - as such, we do not need to call the same function from most of the applications.
* Move openssl(1) from /usr/sbin/openssl to /usr/bin/openssl, since it is notjsing2014-08-261-0/+2743
a system/superuser binary. At the same time, move the source code from its current lib/libssl/src/apps location to a more appropriate home under usr.bin/openssl. ok deraadt@ miod@
generated by cgit v1.2.3-55-g6feb (git 2.39.1) at 2025-04-28 10:27:35 +0000