summaryrefslogtreecommitdiff
path: root/src (follow)
Commit message (Expand)AuthorAgeFilesLines
...
* Replace (&(x)) pattern with &xjob2021-09-072-32/+32
* KNFjob2021-09-072-1478/+1548
* The default Ruby has switched to 3.0tb2021-09-061-2/+2
* new sentence, new line, and tweak wording of previous;jmc2021-09-051-2/+3
* Remove unused variable tmptm in do_body of openssl(1) cainoguchi2021-09-051-8/+2
* Using serial number instead as subject if it is empty in openssl(1) cainoguchi2021-09-052-3/+36
* Check extensions before setting version to v3inoguchi2021-09-051-5/+10
* Use accessor method rather than direct X509 structure accessinoguchi2021-09-051-20/+10
* Factor out the TLSv1.3 code that handles content from TLS records.jsing2021-09-046-80/+238
* Refactor ssl_update_cache. This now matches the logic used for TLS 1.3beck2021-09-041-22/+106
* Improve DTLS hello request handling code.jsing2021-09-041-2/+8
* Change dtls1_get_message_header() to take a CBS.jsing2021-09-043-22/+21
* Improve DTLS record header parsing.jsing2021-09-041-7/+7
* Disable tests that don't work in bluhms regress framework.mbuhl2021-09-041-1/+7
* Add X509 Extensions for IP Addresses and AS Identifiersjob2021-09-031-1/+2
* * add the missing STANDARDS section as noticed by tb@schwarze2021-09-031-3/+20
* Implement a -h option that allows specifying a target host thattb2021-09-031-9/+13
* Now that the issue is fixed, enable test-extensions.pytb2021-09-031-6/+2
* Use SSL3_HM_HEADER_LENGTH instead of the magic number 4.jsing2021-09-031-13/+14
* Ensure that a server hello does not have trailing data.jsing2021-09-031-1/+4
* Ensure that a client hello does not have trailing data.jsing2021-09-031-1/+4
* Set message_size correctly when switching to the legacy stack.jsing2021-09-031-2/+2
* Make Bob happy.bluhm2021-09-031-1/+5
* Call the callback on success in new verifier in a compatible waybeck2021-09-034-19/+56
* Unroll ASN1_ITEM_ref()job2021-09-021-1/+1
* Change OPENSSL_strdup() to strdup()job2021-09-021-1/+1
* Change OPENSSL_malloc to calloc()job2021-09-021-1/+2
* Repair unrolling of static ASN1_ITEM IPAddrBlocks_itjob2021-09-021-0/+11
* Make v3_addr and v3_asid extern constjob2021-09-021-2/+2
* Add err.h for X509error() and friendsjob2021-09-022-0/+2
* Fix OPENSSL_assert() and assert()job2021-09-022-35/+17
* Unroll ASN1_EX_TEMPLATE_TYPE IPAddrBlocksjob2021-09-021-4/+7
* Change the OPENSSL_strdup() to strdup()job2021-09-021-3/+4
* Fix header file includesjob2021-09-022-8/+9
* Move the error put functions from X509V3err() to X509V3error()job2021-09-022-52/+32
* Unroll ASN1_SEQUENCE() ASN1_CHOICE() ASN1_ITEM_TEMPLATE()job2021-09-022-46/+218
* Add -f to usagetb2021-09-021-2/+2
* OPENSSL_assert() is not appropriate in this contextjob2021-09-021-2/+3
* Replace ossl_assert()/assert() with OPENSSL_assert()job2021-09-022-14/+14
* Enable vfork syscall test. Disable SIGSTOP test as it is masked untilmbuhl2021-09-025-6/+45
* We need to allow for either a CERTIFICATE or CERTIFICATE_STATUS messagebeck2021-09-021-2/+3
* Replace OPENSSL_free() with free()job2021-09-022-7/+7
* Unroll IMPLEMENT_ASN1_FUNCTIONS()job2021-09-022-8/+197
* Unroll DECLARE_ASN1_FUNCTIONS()job2021-09-021-9/+56
* Rename DEFINE_STACK_OF() to DECLARE_STACK_OF()job2021-09-021-4/+4
* Lay groundwork to support X.509 v3 extensions for IP Addresses and AS Identif...job2021-09-027-5/+2386
* Import more NetBSD system call regression tests.mbuhl2021-09-0217-50/+2350
* Call the ocsp callback if present and we get no response, instead ofbeck2021-09-021-3/+2
* Use defined constantsinoguchi2021-09-021-16/+16
* Add DB_TYPE_SUSPinoguchi2021-09-021-1/+2