summaryrefslogtreecommitdiff
path: root/src/usr.bin/openssl/ca.c (follow)
Commit message (Expand)AuthorAgeFilesLines
* Reimplement ASN1_PRINTABLE_type() dance in ca.ctb2025-12-211-13/+55
* openssl ca: mechanical change to stop reaching into ASN1_STRINGtb2025-11-271-21/+26
* Remove openssl ca -msie_hacktb2025-04-141-31/+2
* openssl ca: use BN_bn2hex() rather than reimplementing ittb2025-02-251-28/+18
* Remove spkac handling from openssl(1) catb2024-07-081-187/+3
* openssl ca: avoid double free for spkac files without default sectiontb2024-06-231-2/+1
* Zap a useless comment followed by a stray semicolontb2024-02-041-2/+1
* Kill last user of ASN1_time_parse() in the treetb2023-11-131-23/+3
* Teach openssl ca about Ed25519 certificatestb2023-07-021-18/+27
* Rename struct ${app}_config to plain cfgtb2023-03-061-259/+259
* Remove the legacy interactive mode from openssl(1).joshua2022-11-111-6/+4
* Use X509_*get0_pubkey() wherever possible to simplify and clean uptb2022-02-031-14/+6
* Tweak for opaque EVP_MD: use EVP_MD_type(dgst) instead of dgst->type.tb2021-11-211-2/+2
* Stop reaching into structs that will become opaque in ca.ctb2021-10-231-5/+3
* Stop setting enc.modified manually. It's no longer needed.tb2021-10-221-2/+1
* Remove unused variable tmptm in do_body of openssl(1) cainoguchi2021-09-051-8/+2
* Using serial number instead as subject if it is empty in openssl(1) cainoguchi2021-09-051-1/+30
* Check extensions before setting version to v3inoguchi2021-09-051-5/+10
* Use accessor method rather than direct X509 structure accessinoguchi2021-09-051-20/+10
* Use defined constantsinoguchi2021-09-021-16/+16
* Move subject check process after the subject edit processinoguchi2021-09-021-105/+106
* Clean up end of do_body in openssl(1) cainoguchi2021-08-301-6/+8
* Remove NULL check before free in openssl(1) cainoguchi2021-08-301-41/+25
* Check X509_get_notAfter return value in openssl(1) ca.cinoguchi2021-08-281-3/+5
* Use strndup instead of malloc, memcpy and NULL termination in openssl(1) ca.cinoguchi2021-08-281-11/+4
* Remove ASN1_TIME_new and use NULL for X509_gmtime_adj, free tmptm in err pathinoguchi2021-08-281-15/+7
* Unwrap lines in openssl(1) ca.cinoguchi2021-08-281-5/+3
* Avoid leak with X509_REVOKED variable in openssl(1) ca.cinoguchi2021-08-281-1/+3
* Checking the return value in openssl(1) ca.cinoguchi2021-08-281-41/+127
* Compare strcmp and strcasecmp return value with zeroinoguchi2021-07-241-6/+6
* Check pointer variable if it is NULL in ca.cinoguchi2021-07-201-2/+2
* Wrap over 80 long lines in ca.cinoguchi2021-07-151-83/+154
* Explicitly check pointer variable if it is NULL or not in ca.cinoguchi2021-07-151-58/+58
* Remove space between '*' and pointer variable in ca.cinoguchi2021-07-151-56/+56
* Use 'serial' rather than 'ser' in ca.cinoguchi2021-07-151-19/+19
* Convert openssl(1) ca option handlinginoguchi2021-07-151-456/+643
* Remove a redundant memset call.tb2020-12-161-2/+2
* snprintf/vsnprintf return < 0 on error, rather than -1.deraadt2019-07-031-2/+2
* Indent labels with a single space so that diff prototypes are more useful.jsing2018-02-071-12/+12
* simplify startdate/enddate validationbeck2017-05-081-27/+5
* Fix the ca command so that certs it generates have RFC5280 conformant time.beck2017-05-041-16/+56
* rearrange pledge promises into the canonical order; easier to eyeballderaadt2017-01-201-2/+2
* We don't need any VMS access tricks.deraadt2016-08-311-27/+4
* buf[][] with strange use all over the place is ridiculous, especiallyderaadt2016-08-301-15/+14
* more e-mail -> emailmmcc2015-12-241-2/+2
* Exit if a pledge call fails in non-interactive mode.doug2015-10-171-2/+4
* add "tty" for several subcommands of opensslsemarie2015-10-171-2/+2
* Initial support for pledges in openssl(1) commands.doug2015-10-101-1/+6
* add a couple of missing NULL checksbcook2015-09-211-3/+3
* remove vestigial bits of sha-0 and md2 from openssl(1)bcook2015-09-211-2/+2